C13H15BrN2O5 — CID 146564988
1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide (PubChem CID 146564988) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide.
| Compound Name | 1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide |
|---|---|
| PubChem CID | 146564988 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-ethynyl-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxamide bromide |
| SMILES | C#C[C@@]1(O)[C@@H](CO)O[C@@H]([n+]2cccc(C(N)=O)c2)[C@@H]1O.[Br-] |
| InChI | InChI=1S/C13H14N2O5.BrH/c1-2-13(19)9(7-16)20-12(10(13)17)15-5-3-4-8(6-15)11(14)18;/h1,3-6,9-10,12,16-17,19H,7H2,(H-,14,18);1H/t9-,10+,12-,13-;/m1./s1 |
| InChIKey | DLLYFCQDGLOYDX-ZEAWZLFJSA-N |
| XLogP | -5.31 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|