About 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol
1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol (PubChem CID 156745166) has the molecular formula C11H17N2O5+
and a molecular weight of 257.27 g/mol. Its IUPAC name is 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol.
Molecular Properties
| Compound Name | 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol |
| PubChem CID | 156745166 |
| Molecular Formula | C11H17N2O5+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol |
| SMILES | CO.NC(=O)c1ccc[n+](C2OCC(O)C2O)c1 |
| InChI | InChI=1S/C10H12N2O4.CH4O/c11-9(15)6-2-1-3-12(4-6)10-8(14)7(13)5-16-10;1-2/h1-4,7-8,10,13-14H,5H2,(H-,11,15);2H,1H3/p+1 |
| InChIKey | CPUPLFAGJWXQCK-UHFFFAOYSA-O |
| XLogP | -2.07 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol?
The IUPAC name of 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol (CID 156745166) is 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol.
What is the SMILES notation for 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol?
The canonical SMILES for 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol is CO.NC(=O)c1ccc[n+](C2OCC(O)C2O)c1.
What is the InChIKey of 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol?
The InChIKey is CPUPLFAGJWXQCK-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H12N2O4.CH4O/c11-9(15)6-2-1-3-12(4-6)10-8(14)7(13)5-16-10;1-2/h1-4,7-8,10,13-14H,5H2,(H-,11,15);2H,1H3/p+1.
What are the key properties of 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol?
1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol has a molecular weight of 257.27 g/mol, XLogP of -2.07, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydroxyoxolan-2-yl)pyridin-1-ium-3-carboxamide;methanol is sourced from PubChem (CID 156745166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).