C10H14NO4+ — CID 54376888
(2R,3R,4S,5R)-2-pyridin-1-ium-1-yloxane-3,4,5-triol (PubChem CID 54376888) has the molecular formula C10H14NO4+ and a molecular weight of 212.22 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-pyridin-1-ium-1-yloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-pyridin-1-ium-1-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 54376888 |
| Molecular Formula | C10H14NO4+ |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-pyridin-1-ium-1-yloxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H]([n+]2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C10H14NO4/c12-7-6-15-10(9(14)8(7)13)11-4-2-1-3-5-11/h1-5,7-10,12-14H,6H2/q+1/t7-,8+,9-,10-/m1/s1 |
| InChIKey | UXDLBZIJBHKKAT-UTINFBMNSA-N |
| XLogP | -1.41 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|