C5H9FO4 — CID 22858205
(3R,4R,5R)-2-fluorooxane-3,4,5-triol (PubChem CID 22858205) has the molecular formula C5H9FO4 and a molecular weight of 152.12 g/mol. Its IUPAC name is (3R,4R,5R)-2-fluorooxane-3,4,5-triol.
| Compound Name | (3R,4R,5R)-2-fluorooxane-3,4,5-triol |
|---|---|
| PubChem CID | 22858205 |
| Molecular Formula | C5H9FO4 |
| Molecular Weight | 152.12 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | (3R,4R,5R)-2-fluorooxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@H](O)COC(F)[C@@H]1O |
| InChI | InChI=1S/C5H9FO4/c6-5-4(9)3(8)2(7)1-10-5/h2-5,7-9H,1H2/t2-,3-,4-,5?/m1/s1 |
| InChIKey | WHVNYMMWPUHYES-SOOFDHNKSA-N |
| XLogP | -1.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.12 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |