C10H15NO5 — CID 174476280
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-pyridin-1-ium-1-yloxolane-3,4-diol hydroxide (PubChem CID 174476280) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-pyridin-1-ium-1-yloxolane-3,4-diol hydroxide.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-pyridin-1-ium-1-yloxolane-3,4-diol hydroxide |
|---|---|
| PubChem CID | 174476280 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-pyridin-1-ium-1-yloxolane-3,4-diol hydroxide |
| SMILES | OC[C@H]1O[C@@H]([n+]2ccccc2)[C@H](O)[C@@H]1O.[OH-] |
| InChI | InChI=1S/C10H14NO4.H2O/c12-6-7-8(13)9(14)10(15-7)11-4-2-1-3-5-11;/h1-5,7-10,12-14H,6H2;1H2/q+1;/p-1/t7-,8-,9-,10-;/m1./s1 |
| InChIKey | LHZVAKWXKQPHNC-WFFMJNDQSA-M |
| XLogP | -1.59 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|