C11H14ClNO6 — CID 158526570
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylic acid chloride (PubChem CID 158526570) has the molecular formula C11H14ClNO6 and a molecular weight of 291.69 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylic acid chloride.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 158526570 |
| Molecular Formula | C11H14ClNO6 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylic acid chloride |
| SMILES | O=C(O)c1ccc[n+]([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1.[Cl-] |
| InChI | InChI=1S/C11H13NO6.ClH/c13-5-7-8(14)9(15)10(18-7)12-3-1-2-6(4-12)11(16)17;/h1-4,7-10,13-15H,5H2;1H/t7-,8-,9-,10-;/m1./s1 |
| InChIKey | LERKFQBMAWCHDG-WFFMJNDQSA-N |
| XLogP | -4.71 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|