C21H21N2O7+ — CID 167691822
5-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-yl]-2-oxoethyl]-2-methylisoindole-1,3-dione (PubChem CID 167691822) has the molecular formula C21H21N2O7+ and a molecular weight of 413.41 g/mol. Its IUPAC name is 5-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-yl]-2-oxoethyl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-yl]-2-oxoethyl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 167691822 |
| Molecular Formula | C21H21N2O7+ |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 5-[2-[1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-yl]-2-oxoethyl]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(CC(=O)c3ccc[n+]([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3)cc2C1=O |
| InChI | InChI=1S/C21H21N2O7/c1-22-19(28)13-5-4-11(7-14(13)20(22)29)8-15(25)12-3-2-6-23(9-12)21-18(27)17(26)16(10-24)30-21/h2-7,9,16-18,21,24,26-27H,8,10H2,1H3/q+1/t16-,17-,18-,21-/m1/s1 |
| InChIKey | IQXWOMOWSIGKCN-NEYJZJCJSA-N |
| XLogP | -0.76 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|