C23H28N5O10+ — CID 168957684
2-[7-(1-methoxy-1-oxopropan-2-yl)-3-methyl-2,6-dioxopurin-1-yl]ethyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 168957684) has the molecular formula C23H28N5O10+ and a molecular weight of 534.50 g/mol. Its IUPAC name is 2-[7-(1-methoxy-1-oxopropan-2-yl)-3-methyl-2,6-dioxopurin-1-yl]ethyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | 2-[7-(1-methoxy-1-oxopropan-2-yl)-3-methyl-2,6-dioxopurin-1-yl]ethyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 168957684 |
| Molecular Formula | C23H28N5O10+ |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[7-(1-methoxy-1-oxopropan-2-yl)-3-methyl-2,6-dioxopurin-1-yl]ethyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)C(C)n1cnc2c1c(=O)n(CCOC(=O)c1ccc[n+]([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c1)c(=O)n2C |
| InChI | InChI=1S/C23H28N5O10/c1-12(21(33)36-3)28-11-24-18-15(28)19(32)27(23(35)25(18)2)7-8-37-22(34)13-5-4-6-26(9-13)20-17(31)16(30)14(10-29)38-20/h4-6,9,11-12,14,16-17,20,29-31H,7-8,10H2,1-3H3/q+1/t12?,14-,16-,17-,20-/m1/s1 |
| InChIKey | FNIMPQZJBFAZMV-LUKQQSODSA-N |
| XLogP | -2.61 |
| TPSA | 188.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|