C23H22N4O4 — CID 42984471
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 4-phenylbenzoate (PubChem CID 42984471) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 4-phenylbenzoate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 4-phenylbenzoate |
|---|---|
| PubChem CID | 42984471 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 4-phenylbenzoate |
| SMILES | Cn1cnc2c1c(=O)n(CCCOC(=O)c1ccc(-c3ccccc3)cc1)c(=O)n2C |
| InChI | InChI=1S/C23H22N4O4/c1-25-15-24-20-19(25)21(28)27(23(30)26(20)2)13-6-14-31-22(29)18-11-9-17(10-12-18)16-7-4-3-5-8-16/h3-5,7-12,15H,6,13-14H2,1-2H3 |
| InChIKey | JIEHRJLVNFKHFA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|