C18H22N4O3S — CID 84603199
3,7-dimethyl-1-[3-(2-phenoxyethylsulfanyl)propyl]purine-2,6-dione (PubChem CID 84603199) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3,7-dimethyl-1-[3-(2-phenoxyethylsulfanyl)propyl]purine-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[3-(2-phenoxyethylsulfanyl)propyl]purine-2,6-dione |
|---|---|
| PubChem CID | 84603199 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3,7-dimethyl-1-[3-(2-phenoxyethylsulfanyl)propyl]purine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)n(CCCSCCOc1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C18H22N4O3S/c1-20-13-19-16-15(20)17(23)22(18(24)21(16)2)9-6-11-26-12-10-25-14-7-4-3-5-8-14/h3-5,7-8,13H,6,9-12H2,1-2H3 |
| InChIKey | JYPWRNCOZDEDHQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|