C16H21N5O3S — CID 84603482
1-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]propyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 84603482) has the molecular formula C16H21N5O3S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]propyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 84603482 |
| Molecular Formula | C16H21N5O3S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]propyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cc1noc(C)c1CSCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C16H21N5O3S/c1-10-12(11(2)24-18-10)8-25-7-5-6-21-15(22)13-14(17-9-19(13)3)20(4)16(21)23/h9H,5-8H2,1-4H3 |
| InChIKey | FDLSGCIJEJPEJG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|