C24H27N5O3 — CID 78826528
1-[3-(N-benzyl-4-methoxyanilino)propyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 78826528) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[3-(N-benzyl-4-methoxyanilino)propyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[3-(N-benzyl-4-methoxyanilino)propyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 78826528 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[3-(N-benzyl-4-methoxyanilino)propyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(N(CCCn2c(=O)c3c(ncn3C)n(C)c2=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N5O3/c1-26-17-25-22-21(26)23(30)29(24(31)27(22)2)15-7-14-28(16-18-8-5-4-6-9-18)19-10-12-20(32-3)13-11-19/h4-6,8-13,17H,7,14-16H2,1-3H3 |
| InChIKey | ZCNPANVDBMMSHJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|