C20H24N4O5 — CID 23519623
[(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 4-hydroxybenzoate (PubChem CID 23519623) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 4-hydroxybenzoate.
| Compound Name | [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 23519623 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [(2R)-6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl] 4-hydroxybenzoate |
| SMILES | C[C@H](CCCCn1c(=O)c2c(ncn2C)n(C)c1=O)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-13(29-19(27)14-7-9-15(25)10-8-14)6-4-5-11-24-18(26)16-17(21-12-22(16)2)23(3)20(24)28/h7-10,12-13,25H,4-6,11H2,1-3H3/t13-/m1/s1 |
| InChIKey | OXQBGROSSORZIP-CYBMUJFWSA-N |
| XLogP | 1.56 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|