C21H26N4O4 — CID 58710693
6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-methylbenzoate (PubChem CID 58710693) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-methylbenzoate.
| Compound Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-methylbenzoate |
|---|---|
| PubChem CID | 58710693 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OC(C)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C21H26N4O4/c1-14-9-5-6-11-16(14)20(27)29-15(2)10-7-8-12-25-19(26)17-18(22-13-23(17)3)24(4)21(25)28/h5-6,9,11,13,15H,7-8,10,12H2,1-4H3 |
| InChIKey | MLMUWMOVNMCJDD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|