C20H32N6O5 — CID 54093198
6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 4-(2-ethyl-2-methylhydrazinyl)-4-oxobutanoate (PubChem CID 54093198) has the molecular formula C20H32N6O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 4-(2-ethyl-2-methylhydrazinyl)-4-oxobutanoate.
| Compound Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 4-(2-ethyl-2-methylhydrazinyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 54093198 |
| Molecular Formula | C20H32N6O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 6-(3,7-dimethyl-2,6-dioxopurin-1-yl)hexan-2-yl 4-(2-ethyl-2-methylhydrazinyl)-4-oxobutanoate |
| SMILES | CCN(C)NC(=O)CCC(=O)OC(C)CCCCn1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C20H32N6O5/c1-6-24(4)22-15(27)10-11-16(28)31-14(2)9-7-8-12-26-19(29)17-18(21-13-23(17)3)25(5)20(26)30/h13-14H,6-12H2,1-5H3,(H,22,27) |
| InChIKey | MVHPEAPGFQXIMO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 120.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|