C21H27N5O11P+ — CID 168957609
3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate (PubChem CID 168957609) has the molecular formula C21H27N5O11P+ and a molecular weight of 556.45 g/mol. Its IUPAC name is 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate.
| Compound Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 168957609 |
| Molecular Formula | C21H27N5O11P+ |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 3-(3,7-dimethyl-2,6-dioxopurin-1-yl)propyl 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]pyridin-1-ium-3-carboxylate |
| SMILES | Cn1cnc2c1c(=O)n(CCCOC(=O)c1ccc[n+]([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c1)c(=O)n2C |
| InChI | InChI=1S/C21H26N5O11P/c1-23-11-22-17-14(23)18(29)26(21(31)24(17)2)7-4-8-35-20(30)12-5-3-6-25(9-12)19-16(28)15(27)13(37-19)10-36-38(32,33)34/h3,5-6,9,11,13,15-16,19,27-28H,4,7-8,10H2,1-2H3,(H-,32,33,34)/p+1/t13-,15-,16-,19-/m1/s1 |
| InChIKey | ZPJVWFPADLJYOM-NVQRDWNXSA-O |
| XLogP | -2.30 |
| TPSA | 208.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|