C12H17N2O5+ — CID 174148579
(2R,5R)-2-[3-(3-aminooxiran-2-yl)pyridin-1-ium-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 174148579) has the molecular formula C12H17N2O5+ and a molecular weight of 269.28 g/mol. Its IUPAC name is (2R,5R)-2-[3-(3-aminooxiran-2-yl)pyridin-1-ium-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5R)-2-[3-(3-aminooxiran-2-yl)pyridin-1-ium-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 174148579 |
| Molecular Formula | C12H17N2O5+ |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (2R,5R)-2-[3-(3-aminooxiran-2-yl)pyridin-1-ium-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | NC1OC1c1ccc[n+]([C@@H]2O[C@H](CO)C(O)C2O)c1 |
| InChI | InChI=1S/C12H17N2O5/c13-11-10(19-11)6-2-1-3-14(4-6)12-9(17)8(16)7(5-15)18-12/h1-4,7-12,15-17H,5,13H2/q+1/t7-,8?,9?,10?,11?,12-/m1/s1 |
| InChIKey | MJHIQWYIMNUFFX-FZOZPCPUSA-N |
| XLogP | -2.06 |
| TPSA | 112.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|