C16H24N3O6+ — CID 74603526
2-(hydroxymethyl)-6-[3-(1-nitrosopiperidin-2-yl)pyridin-1-ium-1-yl]oxane-3,4,5-triol (PubChem CID 74603526) has the molecular formula C16H24N3O6+ and a molecular weight of 354.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[3-(1-nitrosopiperidin-2-yl)pyridin-1-ium-1-yl]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[3-(1-nitrosopiperidin-2-yl)pyridin-1-ium-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 74603526 |
| Molecular Formula | C16H24N3O6+ |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 2-(hydroxymethyl)-6-[3-(1-nitrosopiperidin-2-yl)pyridin-1-ium-1-yl]oxane-3,4,5-triol |
| SMILES | O=NN1CCCCC1c1ccc[n+](C2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C16H24N3O6/c20-9-12-13(21)14(22)15(23)16(25-12)18-6-3-4-10(8-18)11-5-1-2-7-19(11)17-24/h3-4,6,8,11-16,20-23H,1-2,5,7,9H2/q+1 |
| InChIKey | LJUWLTWWFJFXBU-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 126.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|