C16H20N2O7 — CID 71314992
(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[3-[(2S)-5-oxo-1-(trideuteriomethyl)pyrrolidin-2-yl]pyridin-1-ium-1-yl]oxane-2-carboxylate (PubChem CID 71314992) has the molecular formula C16H20N2O7 and a molecular weight of 355.36 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[3-[(2S)-5-oxo-1-(trideuteriomethyl)pyrrolidin-2-yl]pyridin-1-ium-1-yl]oxane-2-carboxylate.
| Compound Name | (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[3-[(2S)-5-oxo-1-(trideuteriomethyl)pyrrolidin-2-yl]pyridin-1-ium-1-yl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 71314992 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-[3-[(2S)-5-oxo-1-(trideuteriomethyl)pyrrolidin-2-yl]pyridin-1-ium-1-yl]oxane-2-carboxylate |
| SMILES | [2H]C([2H])([2H])N1C(=O)CC[C@H]1c1ccc[n+]([C@H]2O[C@@H](C(=O)[O-])[C@H](O)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C16H20N2O7/c1-17-9(4-5-10(17)19)8-3-2-6-18(7-8)15-13(22)11(20)12(21)14(25-15)16(23)24/h2-3,6-7,9,11-15,20-22H,4-5H2,1H3/t9-,11+,12+,13-,14+,15-/m0/s1/i1D3 |
| InChIKey | XWZCZWKUGIQPJD-NYUYABGESA-N |
| XLogP | -3.00 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|