C13H16NNaO8 — CID 154790014
sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[2-methyl-4-oxo-1-(trideuteriomethyl)-3-pyridinyl]oxy]oxane-2-carboxylate (PubChem CID 154790014) has the molecular formula C13H16NNaO8 and a molecular weight of 340.28 g/mol. Its IUPAC name is sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[2-methyl-4-oxo-1-(trideuteriomethyl)-3-pyridinyl]oxy]oxane-2-carboxylate.
| Compound Name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[2-methyl-4-oxo-1-(trideuteriomethyl)-3-pyridinyl]oxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 154790014 |
| Molecular Formula | C13H16NNaO8 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | sodium (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[2-methyl-4-oxo-1-(trideuteriomethyl)-3-pyridinyl]oxy]oxane-2-carboxylate |
| SMILES | [2H]C([2H])([2H])n1ccc(=O)c(O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)c1C.[Na+] |
| InChI | InChI=1S/C13H17NO8.Na/c1-5-10(6(15)3-4-14(5)2)21-13-9(18)7(16)8(17)11(22-13)12(19)20;/h3-4,7-9,11,13,16-18H,1-2H3,(H,19,20);/q;+1/p-1/t7-,8-,9+,11-,13+;/m0./s1/i2D3; |
| InChIKey | RSDSURUFCMYVRL-KJHKVIQCSA-M |
| XLogP | -6.37 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | -6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |