C10H13N2O4+ — CID 175606728
1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-carboxamide (PubChem CID 175606728) has the molecular formula C10H13N2O4+ and a molecular weight of 225.22 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 175606728 |
| Molecular Formula | C10H13N2O4+ |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-[(2R,3R,4S)-3,4-dihydroxyoxolan-2-yl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+]([C@@H]2OC[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C10H12N2O4/c11-9(15)6-2-1-3-12(4-6)10-8(14)7(13)5-16-10/h1-4,7-8,10,13-14H,5H2,(H-,11,15)/p+1/t7-,8+,10+/m0/s1 |
| InChIKey | XIESCYPVHCOYKF-QXFUBDJGSA-O |
| XLogP | -1.68 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|