C22H30N3O10PS — CID 163971468
S-[2-[[(2R,3R,4R)-4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 163971468) has the molecular formula C22H30N3O10PS and a molecular weight of 559.53 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R)-4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R)-4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 163971468 |
| Molecular Formula | C22H30N3O10PS |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | S-[2-[[(2R,3R,4R)-4-(4-carbamoyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(OC[C@H]1OC[C@](O)(n2cnc(C(N)=O)c2O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N3O10PS/c1-21(2,3)20(29)37-10-9-33-36(31,35-14-7-5-4-6-8-14)34-11-15-17(26)22(30,12-32-15)25-13-24-16(18(23)27)19(25)28/h4-8,13,15,17,26,28,30H,9-12H2,1-3H3,(H2,23,27)/t15-,17-,22-,36?/m1/s1 |
| InChIKey | SQIQEXBXLUQOBC-CBNDEMJGSA-N |
| XLogP | 1.62 |
| TPSA | 192.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|