C23H31N2O10PS — CID 160870222
S-[2-[[(2R,4R,5R)-5-(4-acetyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 160870222) has the molecular formula C23H31N2O10PS and a molecular weight of 558.55 g/mol. Its IUPAC name is S-[2-[[(2R,4R,5R)-5-(4-acetyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,4R,5R)-5-(4-acetyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 160870222 |
| Molecular Formula | C23H31N2O10PS |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | S-[2-[[(2R,4R,5R)-5-(4-acetyl-5-hydroxyimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(OCCSC(=O)C(C)(C)C)Oc3ccccc3)C(O)[C@H]2O)c1O |
| InChI | InChI=1S/C23H31N2O10PS/c1-14(26)17-20(29)25(13-24-17)21-19(28)18(27)16(34-21)12-33-36(31,35-15-8-6-5-7-9-15)32-10-11-37-22(30)23(2,3)4/h5-9,13,16,18-19,21,27-29H,10-12H2,1-4H3/t16-,18?,19-,21-,36?/m1/s1 |
| InChIKey | ZSQKZCSOTMIFTR-AAYPZGTQSA-N |
| XLogP | 2.94 |
| TPSA | 166.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|