C18H23N6O7P — CID 129031381
[(2R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid (PubChem CID 129031381) has the molecular formula C18H23N6O7P and a molecular weight of 466.39 g/mol. Its IUPAC name is [(2R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid.
| Compound Name | [(2R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
|---|---|
| PubChem CID | 129031381 |
| Molecular Formula | C18H23N6O7P |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(2R)-4-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
| SMILES | COc1nc(N)nc2c1ncn2C1(O)CO[C@H](COP(=O)(O)NCc2ccccc2)C1O |
| InChI | InChI=1S/C18H23N6O7P/c1-29-16-13-15(22-17(19)23-16)24(10-20-13)18(26)9-30-12(14(18)25)8-31-32(27,28)21-7-11-5-3-2-4-6-11/h2-6,10,12,14,25-26H,7-9H2,1H3,(H2,19,22,23)(H2,21,27,28)/t12-,14?,18?/m1/s1 |
| InChIKey | RUTIFKHFOISVDH-LVIIFESRSA-N |
| XLogP | -0.27 |
| TPSA | 187.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|