C27H37N6O11P — CID 71516094
ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 71516094) has the molecular formula C27H37N6O11P and a molecular weight of 652.60 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71516094 |
| Molecular Formula | C27H37N6O11P |
| Molecular Weight | 652.60 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)COP(=O)(N[C@H](Cc1ccccc1)C(=O)OCC)OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C27H37N6O11P/c1-5-40-19(34)14-43-45(38,32-17(24(36)41-6-2)12-16-10-8-7-9-11-16)42-13-18-21(35)27(3,37)25(44-18)33-15-29-20-22(33)30-26(28)31-23(20)39-4/h7-11,15,17-18,21,25,35,37H,5-6,12-14H2,1-4H3,(H,32,38)(H2,28,30,31)/t17-,18-,21-,25-,27-,45?/m1/s1 |
| InChIKey | JYWFEGVNVUDWBD-UJJGGAMVSA-N |
| XLogP | 0.89 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.60 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|