C30H43N6O11P — CID 71515708
benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-4-methylpentanoate (PubChem CID 71515708) has the molecular formula C30H43N6O11P and a molecular weight of 694.68 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 71515708 |
| Molecular Formula | C30H43N6O11P |
| Molecular Weight | 694.68 g/mol |
| Exact Mass | 694.27 |
| IUPAC Name | benzyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-oxo-2-propan-2-yloxyethoxy)phosphoryl]amino]-4-methylpentanoate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](CC(C)C)C(=O)OCc2ccccc2)OCC(=O)OC(C)C)[C@@H](O)[C@@]1(C)O |
| InChI | InChI=1S/C30H43N6O11P/c1-17(2)12-20(27(39)43-13-19-10-8-7-9-11-19)35-48(41,45-15-22(37)46-18(3)4)44-14-21-24(38)30(5,40)28(47-21)36-16-32-23-25(36)33-29(31)34-26(23)42-6/h7-11,16-18,20-21,24,28,38,40H,12-15H2,1-6H3,(H,35,41)(H2,31,33,34)/t20-,21+,24+,28+,30+,48?/m0/s1 |
| InChIKey | WABPYNRUNSEJNJ-DYIMYLBQSA-N |
| XLogP | 2.27 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|