C28H39N6O11P — CID 71515872
propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 71515872) has the molecular formula C28H39N6O11P and a molecular weight of 666.63 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71515872 |
| Molecular Formula | C28H39N6O11P |
| Molecular Weight | 666.63 g/mol |
| Exact Mass | 666.24 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(2-ethoxy-2-oxoethoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)COP(=O)(N[C@H](Cc1ccccc1)C(=O)OC(C)C)OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C28H39N6O11P/c1-6-41-20(35)14-43-46(39,33-18(25(37)44-16(2)3)12-17-10-8-7-9-11-17)42-13-19-22(36)28(4,38)26(45-19)34-15-30-21-23(34)31-27(29)32-24(21)40-5/h7-11,15-16,18-19,22,26,36,38H,6,12-14H2,1-5H3,(H,33,39)(H2,29,31,32)/t18-,19-,22-,26-,28-,46?/m1/s1 |
| InChIKey | KDZZDQHOSDAGGT-BOTAKOAWSA-N |
| XLogP | 1.28 |
| TPSA | 228.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|