C26H44N7O10P — CID 53389584
methyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate (PubChem CID 53389584) has the molecular formula C26H44N7O10P and a molecular weight of 645.65 g/mol. Its IUPAC name is methyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 53389584 |
| Molecular Formula | C26H44N7O10P |
| Molecular Weight | 645.65 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | methyl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-methoxypurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-[(1-methoxy-4-methyl-1-oxopentan-2-yl)amino]phosphoryl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NP(=O)(NC(CC(C)C)C(=O)OC)OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C26H44N7O10P/c1-13(2)9-15(22(35)40-7)31-44(38,32-16(10-14(3)4)23(36)41-8)42-11-17-19(34)26(5,37)24(43-17)33-12-28-18-20(33)29-25(27)30-21(18)39-6/h12-17,19,24,34,37H,9-11H2,1-8H3,(H2,27,29,30)(H2,31,32,38)/t15?,16?,17-,19-,24-,26-,44?/m1/s1 |
| InChIKey | ZGHJJGBHSHXPFC-IMBJBPQFSA-N |
| XLogP | 0.91 |
| TPSA | 231.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.65 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|