C24H39N4O8PS2 — CID 155278853
S-[2-[[(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-2-methoxybutoxy]-(2,2-dimethylpropanoylsulfanylmethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 155278853) has the molecular formula C24H39N4O8PS2 and a molecular weight of 606.70 g/mol. Its IUPAC name is S-[2-[[(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-2-methoxybutoxy]-(2,2-dimethylpropanoylsulfanylmethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-2-methoxybutoxy]-(2,2-dimethylpropanoylsulfanylmethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 155278853 |
| Molecular Formula | C24H39N4O8PS2 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | S-[2-[[(2R,3S)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-2-methoxybutoxy]-(2,2-dimethylpropanoylsulfanylmethoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CO[C@H](COP(=O)(OCCSC(=O)C(C)(C)C)OCSC(=O)C(C)(C)C)[C@@H](O)Cc1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C24H39N4O8PS2/c1-23(2,3)21(30)38-11-10-34-37(32,36-15-39-22(31)24(4,5)6)35-13-19(33-7)18(29)12-16-8-9-17-20(25)26-14-27-28(16)17/h8-9,14,18-19,29H,10-13,15H2,1-7H3,(H2,25,26,27)/t18-,19+,37?/m0/s1 |
| InChIKey | IDVVFTZGJBESJQ-LIRMPQSYSA-N |
| XLogP | 3.96 |
| TPSA | 164.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|