C17H23FN4O2Si — CID 59185483
[(2S,3R,4S,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol (PubChem CID 59185483) has the molecular formula C17H23FN4O2Si and a molecular weight of 362.48 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,3R,4S,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185483 |
| Molecular Formula | C17H23FN4O2Si |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(2S,3R,4S,5S)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-fluoro-3-methyloxolan-2-yl]methanol |
| SMILES | C[C@H]1[C@H](F)[C@H](c2cc(C#C[Si](C)(C)C)c3c(N)ncnn23)O[C@@H]1CO |
| InChI | InChI=1S/C17H23FN4O2Si/c1-10-13(8-23)24-16(14(10)18)12-7-11(5-6-25(2,3)4)15-17(19)20-9-21-22(12)15/h7,9-10,13-14,16,23H,8H2,1-4H3,(H2,19,20,21)/t10-,13-,14+,16+/m1/s1 |
| InChIKey | HBLISZKSYINOTF-ADDUCUOXSA-N |
| XLogP | 1.95 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|