C12H11F2N5O3 — CID 118060977
(2R,3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 118060977) has the molecular formula C12H11F2N5O3 and a molecular weight of 311.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 118060977 |
| Molecular Formula | C12H11F2N5O3 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2R,3R,4R,5S)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-2-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@]1(CO)O[C@@H](c2cc(F)c3c(N)ncnn23)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C12H11F2N5O3/c13-5-1-6(19-8(5)11(16)17-4-18-19)9-7(14)10(21)12(2-15,3-20)22-9/h1,4,7,9-10,20-21H,3H2,(H2,16,17,18)/t7-,9-,10-,12+/m0/s1 |
| InChIKey | NSNWXCHPVNWVIX-UWGFBGMZSA-N |
| XLogP | -0.52 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |