C11H12FN7O2 — CID 70927163
[(2S,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azidooxolan-2-yl]methanol (PubChem CID 70927163) has the molecular formula C11H12FN7O2 and a molecular weight of 293.26 g/mol. Its IUPAC name is [(2S,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azidooxolan-2-yl]methanol.
| Compound Name | [(2S,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azidooxolan-2-yl]methanol |
|---|---|
| PubChem CID | 70927163 |
| Molecular Formula | C11H12FN7O2 |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [(2S,5R)-5-(4-amino-5-fluoropyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-azidooxolan-2-yl]methanol |
| SMILES | [N-]=[N+]=N[C@@]1(CO)CC[C@H](c2cc(F)c3c(N)ncnn23)O1 |
| InChI | InChI=1S/C11H12FN7O2/c12-6-3-7(19-9(6)10(13)15-5-16-19)8-1-2-11(4-20,21-8)17-18-14/h3,5,8,20H,1-2,4H2,(H2,13,15,16)/t8-,11+/m1/s1 |
| InChIKey | IIMZZPOCOOHCRH-KCJUWKMLSA-N |
| XLogP | 1.30 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|