C11H11N7O4 — CID 173482677
4-amino-7-[(2R,5R)-5-azido-5-hydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid (PubChem CID 173482677) has the molecular formula C11H11N7O4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 4-amino-7-[(2R,5R)-5-azido-5-hydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid.
| Compound Name | 4-amino-7-[(2R,5R)-5-azido-5-hydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
|---|---|
| PubChem CID | 173482677 |
| Molecular Formula | C11H11N7O4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-amino-7-[(2R,5R)-5-azido-5-hydroxyoxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazine-5-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@@]1(O)CC[C@H](c2cc(C(=O)O)c3c(N)ncnn23)O1 |
| InChI | InChI=1S/C11H11N7O4/c12-9-8-5(10(19)20)3-6(18(8)15-4-14-9)7-1-2-11(21,22-7)16-17-13/h3-4,7,21H,1-2H2,(H,19,20)(H2,12,14,15)/t7-,11-/m1/s1 |
| InChIKey | MBKNJQHHVVKFBN-RDDDGLTNSA-N |
| XLogP | 0.82 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|