C18H25N7O2Si — CID 59185504
[(2S,3S,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol (PubChem CID 59185504) has the molecular formula C18H25N7O2Si and a molecular weight of 399.53 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59185504 |
| Molecular Formula | C18H25N7O2Si |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-2-azido-3,4-dimethyloxolan-2-yl]methanol |
| SMILES | C[C@H]1[C@H](c2cc(C#C[Si](C)(C)C)c3c(N)ncnn23)O[C@@](CO)(N=[N+]=[N-])[C@H]1C |
| InChI | InChI=1S/C18H25N7O2Si/c1-11-12(2)18(9-26,23-24-20)27-16(11)14-8-13(6-7-28(3,4)5)15-17(19)21-10-22-25(14)15/h8,10-12,16,26H,9H2,1-5H3,(H2,19,21,22)/t11-,12+,16-,18-/m1/s1 |
| InChIKey | KEUBRGQESXCBDM-XBCDXLOZSA-N |
| XLogP | 2.88 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|