C13H14N4O4 — CID 142617638
(2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 142617638) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is (2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 142617638 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-ethynyl-2-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C#C[C@]1(CO)O[C@@H](c2ccc3c(N)ncnn23)C(O)C1O |
| InChI | InChI=1S/C13H14N4O4/c1-2-13(5-18)11(20)9(19)10(21-13)7-3-4-8-12(14)15-6-16-17(7)8/h1,3-4,6,9-11,18-20H,5H2,(H2,14,15,16)/t9?,10-,11?,13+/m0/s1 |
| InChIKey | POQGFGJRLOHIJC-MEVFXHMWSA-N |
| XLogP | -1.53 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|