C13H16FN5O2 — CID 143921808
7-[(2R,3R,4S,5R)-4-fluoro-3-methyl-5-(nitrosomethyl)oxolan-2-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 143921808) has the molecular formula C13H16FN5O2 and a molecular weight of 293.30 g/mol. Its IUPAC name is 7-[(2R,3R,4S,5R)-4-fluoro-3-methyl-5-(nitrosomethyl)oxolan-2-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2R,3R,4S,5R)-4-fluoro-3-methyl-5-(nitrosomethyl)oxolan-2-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 143921808 |
| Molecular Formula | C13H16FN5O2 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 7-[(2R,3R,4S,5R)-4-fluoro-3-methyl-5-(nitrosomethyl)oxolan-2-yl]-5-methylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1cc([C@@H]2O[C@H](CN=O)[C@@H](F)[C@@H]2C)n2ncnc(N)c12 |
| InChI | InChI=1S/C13H16FN5O2/c1-6-3-8(19-11(6)13(15)16-5-17-19)12-7(2)10(14)9(21-12)4-18-20/h3,5,7,9-10,12H,4H2,1-2H3,(H2,15,16,17)/t7-,9+,10-,12+/m0/s1 |
| InChIKey | DFOMPIZJCUQJDL-NCIFOGHDSA-N |
| XLogP | 1.80 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |