C12H12N6O4 — CID 134369417
(1R,3R,4R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4,5,6-trihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexane-3-carbonitrile (PubChem CID 134369417) has the molecular formula C12H12N6O4 and a molecular weight of 304.27 g/mol. Its IUPAC name is (1R,3R,4R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4,5,6-trihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexane-3-carbonitrile.
| Compound Name | (1R,3R,4R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4,5,6-trihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexane-3-carbonitrile |
|---|---|
| PubChem CID | 134369417 |
| Molecular Formula | C12H12N6O4 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (1R,3R,4R,5R)-3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4,5,6-trihydroxy-4-methyl-2-oxabicyclo[3.1.0]hexane-3-carbonitrile |
| SMILES | C[C@]1(O)[C@](C#N)(c2cnc3c(N)ncnn23)O[C@@H]2C(O)[C@@]21O |
| InChI | InChI=1S/C12H12N6O4/c1-10(20)11(3-13,22-7-6(19)12(7,10)21)5-2-15-9-8(14)16-4-17-18(5)9/h2,4,6-7,19-21H,1H3,(H2,14,16,17)/t6?,7-,10+,11+,12-/m1/s1 |
| InChIKey | XNOJIIYTKPAEMG-VYLBZREVSA-N |
| XLogP | -2.32 |
| TPSA | 162.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |