C18H19N5O3 — CID 126585080
N-[7-[(2R,4S,5R)-5-ethyl-4-hydroxyoxolan-2-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]benzamide (PubChem CID 126585080) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-[7-[(2R,4S,5R)-5-ethyl-4-hydroxyoxolan-2-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]benzamide.
| Compound Name | N-[7-[(2R,4S,5R)-5-ethyl-4-hydroxyoxolan-2-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]benzamide |
|---|---|
| PubChem CID | 126585080 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | N-[7-[(2R,4S,5R)-5-ethyl-4-hydroxyoxolan-2-yl]imidazo[2,1-f][1,2,4]triazin-4-yl]benzamide |
| SMILES | CC[C@H]1O[C@@H](c2cnc3c(NC(=O)c4ccccc4)ncnn23)C[C@@H]1O |
| InChI | InChI=1S/C18H19N5O3/c1-2-14-13(24)8-15(26-14)12-9-19-17-16(20-10-21-23(12)17)22-18(25)11-6-4-3-5-7-11/h3-7,9-10,13-15,24H,2,8H2,1H3,(H,20,21,22,25)/t13-,14+,15+/m0/s1 |
| InChIKey | JJGYXGKZKZWAGL-RRFJBIMHSA-N |
| XLogP | 1.98 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |