C17H21N5O6 — CID 170197103
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl prop-2-enyl carbonate (PubChem CID 170197103) has the molecular formula C17H21N5O6 and a molecular weight of 391.38 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl prop-2-enyl carbonate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl prop-2-enyl carbonate |
|---|---|
| PubChem CID | 170197103 |
| Molecular Formula | C17H21N5O6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC[C@H]1O[C@@](/C=N/C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H21N5O6/c1-3-6-26-16(25)27-7-11-13(23)14(24)17(28-11,8-19-2)12-5-4-10-15(18)20-9-21-22(10)12/h3-5,8-9,11,13-14,23-24H,1,6-7H2,2H3,(H2,18,20,21)/b19-8+/t11-,13-,14-,17+/m1/s1 |
| InChIKey | GJGYCGMNXOFZCW-YBVYHDMESA-N |
| XLogP | -0.33 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|