C22H33N3O3 — CID 89143690
7-[(2S,4S,5R)-4-butoxy-5-(butoxymethyl)-2-ethenyloxolan-2-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 89143690) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 7-[(2S,4S,5R)-4-butoxy-5-(butoxymethyl)-2-ethenyloxolan-2-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-[(2S,4S,5R)-4-butoxy-5-(butoxymethyl)-2-ethenyloxolan-2-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 89143690 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 7-[(2S,4S,5R)-4-butoxy-5-(butoxymethyl)-2-ethenyloxolan-2-yl]-4-methylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | C=C[C@]1(c2ccc3c(C)ncnn23)C[C@H](OCCCC)[C@@H](COCCCC)O1 |
| InChI | InChI=1S/C22H33N3O3/c1-5-8-12-26-15-20-19(27-13-9-6-2)14-22(7-3,28-20)21-11-10-18-17(4)23-16-24-25(18)21/h7,10-11,16,19-20H,3,5-6,8-9,12-15H2,1-2,4H3/t19-,20+,22+/m0/s1 |
| InChIKey | XBMAPXXOWOJHBE-TUNNFDKTSA-N |
| XLogP | 4.21 |
| TPSA | 57.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|