C16H32O5 — CID 87604924
(4S,5R)-2-methoxy-4-pentoxy-5-(pentoxymethyl)oxolan-2-ol (PubChem CID 87604924) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4S,5R)-2-methoxy-4-pentoxy-5-(pentoxymethyl)oxolan-2-ol.
| Compound Name | (4S,5R)-2-methoxy-4-pentoxy-5-(pentoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 87604924 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (4S,5R)-2-methoxy-4-pentoxy-5-(pentoxymethyl)oxolan-2-ol |
| SMILES | CCCCCOC[C@H]1OC(O)(OC)C[C@@H]1OCCCCC |
| InChI | InChI=1S/C16H32O5/c1-4-6-8-10-19-13-15-14(20-11-9-7-5-2)12-16(17,18-3)21-15/h14-15,17H,4-13H2,1-3H3/t14-,15+,16?/m0/s1 |
| InChIKey | IXUSLQLMNFMKMW-QMRHZFGWSA-N |
| XLogP | 2.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|