C20H43N3O4 — CID 19956025
5-pentoxy-6-(pentoxymethyl)oxan-2-ol;2-propan-2-ylguanidine (PubChem CID 19956025) has the molecular formula C20H43N3O4 and a molecular weight of 389.58 g/mol. Its IUPAC name is 5-pentoxy-6-(pentoxymethyl)oxan-2-ol;2-propan-2-ylguanidine.
| Compound Name | 5-pentoxy-6-(pentoxymethyl)oxan-2-ol;2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 19956025 |
| Molecular Formula | C20H43N3O4 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.33 |
| IUPAC Name | 5-pentoxy-6-(pentoxymethyl)oxan-2-ol;2-propan-2-ylguanidine |
| SMILES | CC(C)N=C(N)N.CCCCCOCC1OC(O)CCC1OCCCCC |
| InChI | InChI=1S/C16H32O4.C4H11N3/c1-3-5-7-11-18-13-15-14(9-10-16(17)20-15)19-12-8-6-4-2;1-3(2)7-4(5)6/h14-17H,3-13H2,1-2H3;3H,1-2H3,(H4,5,6,7) |
| InChIKey | KRKYAGAWNSWXGE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|