C17H37N3O4 — CID 19956021
5-butoxy-6-(butoxymethyl)oxan-2-ol;2-ethylguanidine (PubChem CID 19956021) has the molecular formula C17H37N3O4 and a molecular weight of 347.50 g/mol. Its IUPAC name is 5-butoxy-6-(butoxymethyl)oxan-2-ol;2-ethylguanidine.
| Compound Name | 5-butoxy-6-(butoxymethyl)oxan-2-ol;2-ethylguanidine |
|---|---|
| PubChem CID | 19956021 |
| Molecular Formula | C17H37N3O4 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 5-butoxy-6-(butoxymethyl)oxan-2-ol;2-ethylguanidine |
| SMILES | CCCCOCC1OC(O)CCC1OCCCC.CCN=C(N)N |
| InChI | InChI=1S/C14H28O4.C3H9N3/c1-3-5-9-16-11-13-12(17-10-6-4-2)7-8-14(15)18-13;1-2-6-3(4)5/h12-15H,3-11H2,1-2H3;2H2,1H3,(H4,4,5,6) |
| InChIKey | GCTVZWHYXVTQQZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|