C14H29NO3 — CID 132525337
(2S,3R,4S)-4-amino-2-(nonoxymethyl)oxolan-3-ol (PubChem CID 132525337) has the molecular formula C14H29NO3 and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S,3R,4S)-4-amino-2-(nonoxymethyl)oxolan-3-ol.
| Compound Name | (2S,3R,4S)-4-amino-2-(nonoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 132525337 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | (2S,3R,4S)-4-amino-2-(nonoxymethyl)oxolan-3-ol |
| SMILES | CCCCCCCCCOC[C@@H]1OC[C@H](N)[C@H]1O |
| InChI | InChI=1S/C14H29NO3/c1-2-3-4-5-6-7-8-9-17-11-13-14(16)12(15)10-18-13/h12-14,16H,2-11,15H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | JPCJTRBGGNOZGE-MELADBBJSA-N |
| XLogP | 1.84 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|