C16H30N4O3 — CID 73054242
(2S,3S,4S)-4-amino-2-[(1-octyltriazol-4-yl)methoxymethyl]oxolan-3-ol (PubChem CID 73054242) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S,3S,4S)-4-amino-2-[(1-octyltriazol-4-yl)methoxymethyl]oxolan-3-ol.
| Compound Name | (2S,3S,4S)-4-amino-2-[(1-octyltriazol-4-yl)methoxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 73054242 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | (2S,3S,4S)-4-amino-2-[(1-octyltriazol-4-yl)methoxymethyl]oxolan-3-ol |
| SMILES | CCCCCCCCn1cc(COC[C@@H]2OC[C@H](N)[C@@H]2O)nn1 |
| InChI | InChI=1S/C16H30N4O3/c1-2-3-4-5-6-7-8-20-9-13(18-19-20)10-22-12-15-16(21)14(17)11-23-15/h9,14-16,21H,2-8,10-12,17H2,1H3/t14-,15-,16-/m0/s1 |
| InChIKey | QXLKQGMVXXPQKE-JYJNAYRXSA-N |
| XLogP | 1.24 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|