C18H34N4O3 — CID 73054244
(2S,3S,4S)-4-amino-2-[(1-decyltriazol-4-yl)methoxymethyl]oxolan-3-ol (PubChem CID 73054244) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is (2S,3S,4S)-4-amino-2-[(1-decyltriazol-4-yl)methoxymethyl]oxolan-3-ol.
| Compound Name | (2S,3S,4S)-4-amino-2-[(1-decyltriazol-4-yl)methoxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 73054244 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (2S,3S,4S)-4-amino-2-[(1-decyltriazol-4-yl)methoxymethyl]oxolan-3-ol |
| SMILES | CCCCCCCCCCn1cc(COC[C@@H]2OC[C@H](N)[C@@H]2O)nn1 |
| InChI | InChI=1S/C18H34N4O3/c1-2-3-4-5-6-7-8-9-10-22-11-15(20-21-22)12-24-14-17-18(23)16(19)13-25-17/h11,16-18,23H,2-10,12-14,19H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | CDPSIMLMULZONU-BZSNNMDCSA-N |
| XLogP | 2.02 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|