C29H52N6O6 — CID 71588093
2-(hydroxymethyl)-6-methoxy-4,5-bis[(1-octyltriazol-4-yl)methoxy]oxan-3-ol (PubChem CID 71588093) has the molecular formula C29H52N6O6 and a molecular weight of 580.77 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-methoxy-4,5-bis[(1-octyltriazol-4-yl)methoxy]oxan-3-ol.
| Compound Name | 2-(hydroxymethyl)-6-methoxy-4,5-bis[(1-octyltriazol-4-yl)methoxy]oxan-3-ol |
|---|---|
| PubChem CID | 71588093 |
| Molecular Formula | C29H52N6O6 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.39 |
| IUPAC Name | 2-(hydroxymethyl)-6-methoxy-4,5-bis[(1-octyltriazol-4-yl)methoxy]oxan-3-ol |
| SMILES | CCCCCCCCn1cc(COC2C(OC)OC(CO)C(O)C2OCc2cn(CCCCCCCC)nn2)nn1 |
| InChI | InChI=1S/C29H52N6O6/c1-4-6-8-10-12-14-16-34-18-23(30-32-34)21-39-27-26(37)25(20-36)41-29(38-3)28(27)40-22-24-19-35(33-31-24)17-15-13-11-9-7-5-2/h18-19,25-29,36-37H,4-17,20-22H2,1-3H3 |
| InChIKey | HPRWAKYTCFQBEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|