C21H39N3O6 — CID 102450681
(2S,3R,4S,5S,6R)-2-[[1-(2-butyloctyl)triazol-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 102450681) has the molecular formula C21H39N3O6 and a molecular weight of 429.56 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[1-(2-butyloctyl)triazol-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[1-(2-butyloctyl)triazol-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102450681 |
| Molecular Formula | C21H39N3O6 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[1-(2-butyloctyl)triazol-4-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCC(CCCC)Cn1cc(CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C21H39N3O6/c1-3-5-7-8-10-15(9-6-4-2)11-24-12-16(22-23-24)14-29-21-20(28)19(27)18(26)17(13-25)30-21/h12,15,17-21,25-28H,3-11,13-14H2,1-2H3/t15?,17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | GLMOXZUAZSOMPL-GGWAWNLDSA-N |
| XLogP | 1.37 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|