C25H26N8O10 — CID 53390628
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[1-(4-nitrophenyl)triazol-4-yl]methoxy]oxan-3-ol (PubChem CID 53390628) has the molecular formula C25H26N8O10 and a molecular weight of 598.53 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[1-(4-nitrophenyl)triazol-4-yl]methoxy]oxan-3-ol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[1-(4-nitrophenyl)triazol-4-yl]methoxy]oxan-3-ol |
|---|---|
| PubChem CID | 53390628 |
| Molecular Formula | C25H26N8O10 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[1-(4-nitrophenyl)triazol-4-yl]methoxy]oxan-3-ol |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OCc2cn(-c3ccc([N+](=O)[O-])cc3)nn2)[C@H]1OCc1cn(-c2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C25H26N8O10/c1-40-25-24(42-14-16-11-31(29-27-16)18-4-8-20(9-5-18)33(38)39)23(22(35)21(12-34)43-25)41-13-15-10-30(28-26-15)17-2-6-19(7-3-17)32(36)37/h2-11,21-25,34-35H,12-14H2,1H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | WJJKNOWPZNXKDZ-RXFVIIJJSA-N |
| XLogP | 0.86 |
| TPSA | 225.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|