C18H40N2O5 — CID 158114005
(3S,4R)-5-amino-3-methyl-2-(octoxymethyl)oxan-4-ol;N-methylacetamide;hydrate (PubChem CID 158114005) has the molecular formula C18H40N2O5 and a molecular weight of 364.53 g/mol. Its IUPAC name is (3S,4R)-5-amino-3-methyl-2-(octoxymethyl)oxan-4-ol;N-methylacetamide;hydrate.
| Compound Name | (3S,4R)-5-amino-3-methyl-2-(octoxymethyl)oxan-4-ol;N-methylacetamide;hydrate |
|---|---|
| PubChem CID | 158114005 |
| Molecular Formula | C18H40N2O5 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | (3S,4R)-5-amino-3-methyl-2-(octoxymethyl)oxan-4-ol;N-methylacetamide;hydrate |
| SMILES | CCCCCCCCOCC1OCC(N)[C@H](O)[C@@H]1C.CNC(C)=O.O |
| InChI | InChI=1S/C15H31NO3.C3H7NO.H2O/c1-3-4-5-6-7-8-9-18-11-14-12(2)15(17)13(16)10-19-14;1-3(5)4-2;/h12-15,17H,3-11,16H2,1-2H3;1-2H3,(H,4,5);1H2/t12-,13?,14?,15-;;/m1../s1 |
| InChIKey | BPFFGVAZGQSXKO-YSNZFERFSA-N |
| XLogP | 1.01 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|